C10H15N — CID 123179221
6-methyl-2,3,4,6,7,8-hexahydroquinoline (PubChem CID 123179221) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 6-methyl-2,3,4,6,7,8-hexahydroquinoline.
| Compound Name | 6-methyl-2,3,4,6,7,8-hexahydroquinoline |
|---|---|
| PubChem CID | 123179221 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 6-methyl-2,3,4,6,7,8-hexahydroquinoline |
| SMILES | CC1C=C2CCCN=C2CC1 |
| InChI | InChI=1S/C10H15N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h7-8H,2-6H2,1H3 |
| InChIKey | GBJRETNQLUHPCG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |