C12H10Cl2F3N3S — CID 123180224
2-(2H-azirin-2-yl)-N'-[2,4-dichloro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]ethanimidamide (PubChem CID 123180224) has the molecular formula C12H10Cl2F3N3S and a molecular weight of 356.20 g/mol. Its IUPAC name is 2-(2H-azirin-2-yl)-N'-[2,4-dichloro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]ethanimidamide.
| Compound Name | 2-(2H-azirin-2-yl)-N'-[2,4-dichloro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 123180224 |
| Molecular Formula | C12H10Cl2F3N3S |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 2-(2H-azirin-2-yl)-N'-[2,4-dichloro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]ethanimidamide |
| SMILES | N/C(CC1C=N1)=N\c1cc(SCC(F)(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl2F3N3S/c13-7-2-8(14)10(21-5-12(15,16)17)3-9(7)20-11(18)1-6-4-19-6/h2-4,6H,1,5H2,(H2,18,20) |
| InChIKey | BPOPUNDPGARMLS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|