About 5,6-dihydro-1H-1,8-naphthyridin-4-one
5,6-dihydro-1H-1,8-naphthyridin-4-one (PubChem CID 123180588) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 5,6-dihydro-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 5,6-dihydro-1H-1,8-naphthyridin-4-one |
| PubChem CID | 123180588 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 5,6-dihydro-1H-1,8-naphthyridin-4-one |
| SMILES | O=c1cc[nH]c2c1CCC=N2 |
| InChI | InChI=1S/C8H8N2O/c11-7-3-5-10-8-6(7)2-1-4-9-8/h3-5H,1-2H2,(H,10,11) |
| InChIKey | WHCWLJMTDIJXAW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-1H-1,8-naphthyridin-4-one?
The IUPAC name of 5,6-dihydro-1H-1,8-naphthyridin-4-one (CID 123180588) is 5,6-dihydro-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for 5,6-dihydro-1H-1,8-naphthyridin-4-one?
The canonical SMILES for 5,6-dihydro-1H-1,8-naphthyridin-4-one is O=c1cc[nH]c2c1CCC=N2.
What is the InChIKey of 5,6-dihydro-1H-1,8-naphthyridin-4-one?
The InChIKey is WHCWLJMTDIJXAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-7-3-5-10-8-6(7)2-1-4-9-8/h3-5H,1-2H2,(H,10,11).
What are the key properties of 5,6-dihydro-1H-1,8-naphthyridin-4-one?
5,6-dihydro-1H-1,8-naphthyridin-4-one has a molecular weight of 148.16 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 123180588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).