C17H16F3N9 — CID 123180700
3-hydrazinyl-N-(pyrazolo[1,5-a]pyridin-5-ylmethyl)-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazin-2-amine (PubChem CID 123180700) has the molecular formula C17H16F3N9 and a molecular weight of 403.37 g/mol. Its IUPAC name is 3-hydrazinyl-N-(pyrazolo[1,5-a]pyridin-5-ylmethyl)-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazin-2-amine.
| Compound Name | 3-hydrazinyl-N-(pyrazolo[1,5-a]pyridin-5-ylmethyl)-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 123180700 |
| Molecular Formula | C17H16F3N9 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-hydrazinyl-N-(pyrazolo[1,5-a]pyridin-5-ylmethyl)-6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazin-2-amine |
| SMILES | NNc1ncc(-c2cnn(CC(F)(F)F)c2)nc1NCc1ccn2nccc2c1 |
| InChI | InChI=1S/C17H16F3N9/c18-17(19,20)10-28-9-12(7-25-28)14-8-23-16(27-21)15(26-14)22-6-11-2-4-29-13(5-11)1-3-24-29/h1-5,7-9H,6,10,21H2,(H,22,26)(H,23,27) |
| InChIKey | RZQWPTBBVOAXIB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|