C10H16N+ — CID 123180711
3,6-dimethyl-1-prop-1-enyl-3,4-dihydropyridin-1-ium (PubChem CID 123180711) has the molecular formula C10H16N+ and a molecular weight of 150.24 g/mol. Its IUPAC name is 3,6-dimethyl-1-prop-1-enyl-3,4-dihydropyridin-1-ium.
| Compound Name | 3,6-dimethyl-1-prop-1-enyl-3,4-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 123180711 |
| Molecular Formula | C10H16N+ |
| Molecular Weight | 150.24 g/mol |
| Exact Mass | 150.13 |
| IUPAC Name | 3,6-dimethyl-1-prop-1-enyl-3,4-dihydropyridin-1-ium |
| SMILES | CC=C[N+]1=CC(C)CC=C1C |
| InChI | InChI=1S/C10H16N/c1-4-7-11-8-9(2)5-6-10(11)3/h4,6-9H,5H2,1-3H3/q+1 |
| InChIKey | KWWDRUWAONFXTI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|