C29H30N7O2+ — CID 123180980
[4-[(4-methylpiperazin-1-yl)methyl]benzoyl]-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]-oxoazanium (PubChem CID 123180980) has the molecular formula C29H30N7O2+ and a molecular weight of 508.61 g/mol. Its IUPAC name is [4-[(4-methylpiperazin-1-yl)methyl]benzoyl]-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]-oxoazanium.
| Compound Name | [4-[(4-methylpiperazin-1-yl)methyl]benzoyl]-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]-oxoazanium |
|---|---|
| PubChem CID | 123180980 |
| Molecular Formula | C29H30N7O2+ |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | [4-[(4-methylpiperazin-1-yl)methyl]benzoyl]-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]-oxoazanium |
| SMILES | Cc1ccc([N+](=O)C(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C29H30N7O2/c1-21-5-10-25(18-27(21)33-29-31-13-11-26(32-29)24-4-3-12-30-19-24)36(38)28(37)23-8-6-22(7-9-23)20-35-16-14-34(2)15-17-35/h3-13,18-19H,14-17,20H2,1-2H3,(H,31,32,33)/q+1 |
| InChIKey | QPIILEABPRNTLN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|