About N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide
N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide (PubChem CID 123181161) has the molecular formula C11H21NO2S
and a molecular weight of 231.36 g/mol. Its IUPAC name is N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide |
| PubChem CID | 123181161 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide |
| SMILES | CC(C)=CCCC(C)=CCNS(C)(=O)=O |
| InChI | InChI=1S/C11H21NO2S/c1-10(2)6-5-7-11(3)8-9-12-15(4,13)14/h6,8,12H,5,7,9H2,1-4H3 |
| InChIKey | TUMFQSMEYGBGCZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide?
The IUPAC name of N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide (CID 123181161) is N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide.
What is the SMILES notation for N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide?
The canonical SMILES for N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide is CC(C)=CCCC(C)=CCNS(C)(=O)=O.
What is the InChIKey of N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide?
The InChIKey is TUMFQSMEYGBGCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2S/c1-10(2)6-5-7-11(3)8-9-12-15(4,13)14/h6,8,12H,5,7,9H2,1-4H3.
What are the key properties of N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide?
N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide has a molecular weight of 231.36 g/mol, XLogP of 2.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,7-dimethylocta-2,6-dienyl)methanesulfonamide is sourced from PubChem (CID 123181161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).