About tert-butyl(dimethyl)silane;(2S)-2-methylbutanal
tert-butyl(dimethyl)silane;(2S)-2-methylbutanal (PubChem CID 123181168) has the molecular formula C11H26OSi
and a molecular weight of 202.41 g/mol. Its IUPAC name is tert-butyl(dimethyl)silane;(2S)-2-methylbutanal.
Molecular Properties
| Compound Name | tert-butyl(dimethyl)silane;(2S)-2-methylbutanal |
| PubChem CID | 123181168 |
| Molecular Formula | C11H26OSi |
| Molecular Weight | 202.41 g/mol |
| Exact Mass | 202.18 |
| IUPAC Name | tert-butyl(dimethyl)silane;(2S)-2-methylbutanal |
| SMILES | CC[C@H](C)C=O.C[SiH](C)C(C)(C)C |
| InChI | InChI=1S/C6H16Si.C5H10O/c1-6(2,3)7(4)5;1-3-5(2)4-6/h7H,1-5H3;4-5H,3H2,1-2H3/t;5-/m.0/s1 |
| InChIKey | KOYXRMCNQBODIX-ZSCHJXSPSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(dimethyl)silane;(2S)-2-methylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(dimethyl)silane;(2S)-2-methylbutanal?
The IUPAC name of tert-butyl(dimethyl)silane;(2S)-2-methylbutanal (CID 123181168) is tert-butyl(dimethyl)silane;(2S)-2-methylbutanal.
What is the SMILES notation for tert-butyl(dimethyl)silane;(2S)-2-methylbutanal?
The canonical SMILES for tert-butyl(dimethyl)silane;(2S)-2-methylbutanal is CC[C@H](C)C=O.C[SiH](C)C(C)(C)C.
What is the InChIKey of tert-butyl(dimethyl)silane;(2S)-2-methylbutanal?
The InChIKey is KOYXRMCNQBODIX-ZSCHJXSPSA-N. The full InChI is InChI=1S/C6H16Si.C5H10O/c1-6(2,3)7(4)5;1-3-5(2)4-6/h7H,1-5H3;4-5H,3H2,1-2H3/t;5-/m.0/s1.
What are the key properties of tert-butyl(dimethyl)silane;(2S)-2-methylbutanal?
tert-butyl(dimethyl)silane;(2S)-2-methylbutanal has a molecular weight of 202.41 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(dimethyl)silane;(2S)-2-methylbutanal is sourced from PubChem (CID 123181168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).