C22H32N2O — CID 123181264
(2E,6Z)-2-methanimidoyl-4,7-dimethyl-N-(4-methylhexa-4,5-dienyl)-5-methylideneundeca-2,6,8-trienamide (PubChem CID 123181264) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is (2E,6Z)-2-methanimidoyl-4,7-dimethyl-N-(4-methylhexa-4,5-dienyl)-5-methylideneundeca-2,6,8-trienamide.
| Compound Name | (2E,6Z)-2-methanimidoyl-4,7-dimethyl-N-(4-methylhexa-4,5-dienyl)-5-methylideneundeca-2,6,8-trienamide |
|---|---|
| PubChem CID | 123181264 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | (2E,6Z)-2-methanimidoyl-4,7-dimethyl-N-(4-methylhexa-4,5-dienyl)-5-methylideneundeca-2,6,8-trienamide |
| SMILES | [H]/N=C/C(=C\C(C)C(=C)/C=C(/C)C=CCC)C(=O)NCCCC(C)=C=C |
| InChI | InChI=1S/C22H32N2O/c1-7-9-11-18(4)14-19(5)20(6)15-21(16-23)22(25)24-13-10-12-17(3)8-2/h9,11,14-16,20,23H,2,5,7,10,12-13H2,1,3-4,6H3,(H,24,25)/b11-9?,18-14-,21-15+,23-16+ |
| InChIKey | TZFCESKGTJVULZ-LGGKGPADSA-N |
| XLogP | 5.29 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|