C13H18F2N6O3 — CID 123181667
N-[2-amino-2-(3-methylimidazol-4-yl)ethoxy]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 123181667) has the molecular formula C13H18F2N6O3 and a molecular weight of 344.32 g/mol. Its IUPAC name is N-[2-amino-2-(3-methylimidazol-4-yl)ethoxy]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | N-[2-amino-2-(3-methylimidazol-4-yl)ethoxy]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 123181667 |
| Molecular Formula | C13H18F2N6O3 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[2-amino-2-(3-methylimidazol-4-yl)ethoxy]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | Cn1cncc1C(N)CONC(=O)C1CC(F)(F)C2CN1C(=O)N2 |
| InChI | InChI=1S/C13H18F2N6O3/c1-20-6-17-3-9(20)7(16)5-24-19-11(22)8-2-13(14,15)10-4-21(8)12(23)18-10/h3,6-8,10H,2,4-5,16H2,1H3,(H,18,23)(H,19,22) |
| InChIKey | VXPDAVLMRVZDOK-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|