C25H26N4O4 — CID 123181846
oxolan-3-ylmethyl N-[3-[[1-(4-cyanophenyl)-4-oxopyridazin-3-yl]methyl]-2-methylcyclohexa-1,4-dien-1-yl]carbamate (PubChem CID 123181846) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is oxolan-3-ylmethyl N-[3-[[1-(4-cyanophenyl)-4-oxopyridazin-3-yl]methyl]-2-methylcyclohexa-1,4-dien-1-yl]carbamate.
| Compound Name | oxolan-3-ylmethyl N-[3-[[1-(4-cyanophenyl)-4-oxopyridazin-3-yl]methyl]-2-methylcyclohexa-1,4-dien-1-yl]carbamate |
|---|---|
| PubChem CID | 123181846 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | oxolan-3-ylmethyl N-[3-[[1-(4-cyanophenyl)-4-oxopyridazin-3-yl]methyl]-2-methylcyclohexa-1,4-dien-1-yl]carbamate |
| SMILES | CC1=C(NC(=O)OCC2CCOC2)CC=CC1Cc1nn(-c2ccc(C#N)cc2)ccc1=O |
| InChI | InChI=1S/C25H26N4O4/c1-17-20(3-2-4-22(17)27-25(31)33-16-19-10-12-32-15-19)13-23-24(30)9-11-29(28-23)21-7-5-18(14-26)6-8-21/h2-3,5-9,11,19-20H,4,10,12-13,15-16H2,1H3,(H,27,31) |
| InChIKey | MUHYLGKEPNLDNN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|