C11H15N4O+ — CID 123182116
2-amino-8-ethyl-3,4-dimethylpyrido[2,3-d]pyrimidin-3-ium-7-one (PubChem CID 123182116) has the molecular formula C11H15N4O+ and a molecular weight of 219.27 g/mol. Its IUPAC name is 2-amino-8-ethyl-3,4-dimethylpyrido[2,3-d]pyrimidin-3-ium-7-one.
| Compound Name | 2-amino-8-ethyl-3,4-dimethylpyrido[2,3-d]pyrimidin-3-ium-7-one |
|---|---|
| PubChem CID | 123182116 |
| Molecular Formula | C11H15N4O+ |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-amino-8-ethyl-3,4-dimethylpyrido[2,3-d]pyrimidin-3-ium-7-one |
| SMILES | CCn1c(=O)ccc2c(C)[n+](C)c(N)nc21 |
| InChI | InChI=1S/C11H14N4O/c1-4-15-9(16)6-5-8-7(2)14(3)11(12)13-10(8)15/h5-6,12H,4H2,1-3H3/p+1 |
| InChIKey | QDOUMELHMRIOEK-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|