C25H21F6N5OS — CID 123182713
5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-(1H-indazol-5-yl)ethenyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-ol (PubChem CID 123182713) has the molecular formula C25H21F6N5OS and a molecular weight of 553.53 g/mol. Its IUPAC name is 5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-(1H-indazol-5-yl)ethenyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-ol.
| Compound Name | 5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-(1H-indazol-5-yl)ethenyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 123182713 |
| Molecular Formula | C25H21F6N5OS |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-(1H-indazol-5-yl)ethenyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-ol |
| SMILES | CN1CCN(c2nc(O)c(C(=Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c3ccc4[nH]ncc4c3)s2)CC1 |
| InChI | InChI=1S/C25H21F6N5OS/c1-35-6-8-36(9-7-35)23-33-22(37)21(38-23)18(14-3-5-20-16(10-14)13-32-34-20)11-15-2-4-17(24(26,27)28)12-19(15)25(29,30)31/h2-5,10-13,37H,6-9H2,1H3,(H,32,34) |
| InChIKey | HYNYVSLELSLBCX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|