C8H12N4O — CID 123182720
1,3,6-trimethyl-4,7-dihydropurin-2-one (PubChem CID 123182720) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 1,3,6-trimethyl-4,7-dihydropurin-2-one.
| Compound Name | 1,3,6-trimethyl-4,7-dihydropurin-2-one |
|---|---|
| PubChem CID | 123182720 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1,3,6-trimethyl-4,7-dihydropurin-2-one |
| SMILES | CC1=C2NC=NC2N(C)C(=O)N1C |
| InChI | InChI=1S/C8H12N4O/c1-5-6-7(10-4-9-6)12(3)8(13)11(5)2/h4,7H,1-3H3,(H,9,10) |
| InChIKey | CXVGEIFSAWOYMR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |