C30H29F4N6O2+ — CID 123183009
4-(3-ethylpyridine-4-carbonyl)-13-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methyl-15-propan-2-yl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one (PubChem CID 123183009) has the molecular formula C30H29F4N6O2+ and a molecular weight of 581.59 g/mol. Its IUPAC name is 4-(3-ethylpyridine-4-carbonyl)-13-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methyl-15-propan-2-yl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one.
| Compound Name | 4-(3-ethylpyridine-4-carbonyl)-13-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methyl-15-propan-2-yl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
|---|---|
| PubChem CID | 123183009 |
| Molecular Formula | C30H29F4N6O2+ |
| Molecular Weight | 581.59 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 4-(3-ethylpyridine-4-carbonyl)-13-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methyl-15-propan-2-yl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
| SMILES | CCc1cnccc1C(=O)N1CCN2C(=O)c3cn4nc(-c5ccc(C(F)(F)F)c(F)c5)cc(C(C)C)c4[n+]3C2(C)C1 |
| InChI | InChI=1S/C30H29F4N6O2/c1-5-18-14-35-9-8-20(18)27(41)37-10-11-38-28(42)25-15-39-26(40(25)29(38,4)16-37)21(17(2)3)13-24(36-39)19-6-7-22(23(31)12-19)30(32,33)34/h6-9,12-15,17H,5,10-11,16H2,1-4H3/q+1 |
| InChIKey | BXJJBPSFMZBHRS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|