About 2-methylbutanamide;oxido sulfite
2-methylbutanamide;oxido sulfite (PubChem CID 123183278) has the molecular formula C5H11NO5S-2
and a molecular weight of 197.21 g/mol. Its IUPAC name is 2-methylbutanamide;oxido sulfite.
Molecular Properties
| Compound Name | 2-methylbutanamide;oxido sulfite |
| PubChem CID | 123183278 |
| Molecular Formula | C5H11NO5S-2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-methylbutanamide;oxido sulfite |
| SMILES | CCC(C)C(N)=O.O=S([O-])O[O-] |
| InChI | InChI=1S/C5H11NO.H2O4S/c1-3-4(2)5(6)7;1-4-5(2)3/h4H,3H2,1-2H3,(H2,6,7);1H,(H,2,3)/p-2 |
| InChIKey | QAGQUGCJDVMOCN-UHFFFAOYSA-L |
| XLogP | -1.41 |
| TPSA | 115.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutanamide;oxido sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutanamide;oxido sulfite?
The IUPAC name of 2-methylbutanamide;oxido sulfite (CID 123183278) is 2-methylbutanamide;oxido sulfite.
What is the SMILES notation for 2-methylbutanamide;oxido sulfite?
The canonical SMILES for 2-methylbutanamide;oxido sulfite is CCC(C)C(N)=O.O=S([O-])O[O-].
What is the InChIKey of 2-methylbutanamide;oxido sulfite?
The InChIKey is QAGQUGCJDVMOCN-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H11NO.H2O4S/c1-3-4(2)5(6)7;1-4-5(2)3/h4H,3H2,1-2H3,(H2,6,7);1H,(H,2,3)/p-2.
What are the key properties of 2-methylbutanamide;oxido sulfite?
2-methylbutanamide;oxido sulfite has a molecular weight of 197.21 g/mol, XLogP of -1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutanamide;oxido sulfite is sourced from PubChem (CID 123183278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).