C21H19F3N4O — CID 123183340
N-[4-[3-(1,1-difluorobut-3-enyl)-1-methylpyrazol-5-yl]-3-fluorophenyl]-3-methylpyridine-4-carboxamide (PubChem CID 123183340) has the molecular formula C21H19F3N4O and a molecular weight of 400.40 g/mol. Its IUPAC name is N-[4-[3-(1,1-difluorobut-3-enyl)-1-methylpyrazol-5-yl]-3-fluorophenyl]-3-methylpyridine-4-carboxamide.
| Compound Name | N-[4-[3-(1,1-difluorobut-3-enyl)-1-methylpyrazol-5-yl]-3-fluorophenyl]-3-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 123183340 |
| Molecular Formula | C21H19F3N4O |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[4-[3-(1,1-difluorobut-3-enyl)-1-methylpyrazol-5-yl]-3-fluorophenyl]-3-methylpyridine-4-carboxamide |
| SMILES | C=CCC(F)(F)c1cc(-c2ccc(NC(=O)c3ccncc3C)cc2F)n(C)n1 |
| InChI | InChI=1S/C21H19F3N4O/c1-4-8-21(23,24)19-11-18(28(3)27-19)16-6-5-14(10-17(16)22)26-20(29)15-7-9-25-12-13(15)2/h4-7,9-12H,1,8H2,2-3H3,(H,26,29) |
| InChIKey | HSNAZSYHETTZTC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|