C10H15F4N — CID 123185746
(E)-N-butan-2-yl-1,1,5,5-tetrafluoro-4-methylpent-3-en-2-imine (PubChem CID 123185746) has the molecular formula C10H15F4N and a molecular weight of 225.23 g/mol. Its IUPAC name is (E)-N-butan-2-yl-1,1,5,5-tetrafluoro-4-methylpent-3-en-2-imine.
| Compound Name | (E)-N-butan-2-yl-1,1,5,5-tetrafluoro-4-methylpent-3-en-2-imine |
|---|---|
| PubChem CID | 123185746 |
| Molecular Formula | C10H15F4N |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (E)-N-butan-2-yl-1,1,5,5-tetrafluoro-4-methylpent-3-en-2-imine |
| SMILES | CCC(C)/N=C(/C=C(\C)C(F)F)C(F)F |
| InChI | InChI=1S/C10H15F4N/c1-4-7(3)15-8(10(13)14)5-6(2)9(11)12/h5,7,9-10H,4H2,1-3H3/b6-5+,15-8- |
| InChIKey | RVXNFPZFGKEYHP-RSIRFQHMSA-N |
| XLogP | 3.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|