C19H30O2Si — CID 123186385
trimethyl-[9-methyl-5-(oxan-4-yloxy)deca-3,5,9-trien-1-ynyl]silane (PubChem CID 123186385) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is trimethyl-[9-methyl-5-(oxan-4-yloxy)deca-3,5,9-trien-1-ynyl]silane.
| Compound Name | trimethyl-[9-methyl-5-(oxan-4-yloxy)deca-3,5,9-trien-1-ynyl]silane |
|---|---|
| PubChem CID | 123186385 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | trimethyl-[9-methyl-5-(oxan-4-yloxy)deca-3,5,9-trien-1-ynyl]silane |
| SMILES | C=C(C)CCC=C(C=CC#C[Si](C)(C)C)OC1CCOCC1 |
| InChI | InChI=1S/C19H30O2Si/c1-17(2)9-8-11-18(10-6-7-16-22(3,4)5)21-19-12-14-20-15-13-19/h6,10-11,19H,1,8-9,12-15H2,2-5H3 |
| InChIKey | JUDSQOBZURSYFY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|