C27H27F3N7O2+ — CID 123187088
15-tert-butyl-2-methyl-4-(1H-pyrazole-5-carbonyl)-13-[4-(trifluoromethyl)phenyl]-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one (PubChem CID 123187088) has the molecular formula C27H27F3N7O2+ and a molecular weight of 538.55 g/mol. Its IUPAC name is 15-tert-butyl-2-methyl-4-(1H-pyrazole-5-carbonyl)-13-[4-(trifluoromethyl)phenyl]-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one.
| Compound Name | 15-tert-butyl-2-methyl-4-(1H-pyrazole-5-carbonyl)-13-[4-(trifluoromethyl)phenyl]-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
|---|---|
| PubChem CID | 123187088 |
| Molecular Formula | C27H27F3N7O2+ |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 15-tert-butyl-2-methyl-4-(1H-pyrazole-5-carbonyl)-13-[4-(trifluoromethyl)phenyl]-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
| SMILES | CC(C)(C)c1cc(-c2ccc(C(F)(F)F)cc2)nn2cc3[n+](c12)C1(C)CN(C(=O)c2ccn[nH]2)CCN1C3=O |
| InChI | InChI=1S/C27H26F3N7O2/c1-25(2,3)18-13-20(16-5-7-17(8-6-16)27(28,29)30)33-36-14-21-24(39)35-12-11-34(23(38)19-9-10-31-32-19)15-26(35,4)37(21)22(18)36/h5-10,13-14H,11-12,15H2,1-4H3/p+1 |
| InChIKey | JMOPDWCAUGWPPW-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|