About 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane
5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane (PubChem CID 123187249) has the molecular formula C21H36
and a molecular weight of 288.52 g/mol. Its IUPAC name is 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane.
Molecular Properties
| Compound Name | 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane |
| PubChem CID | 123187249 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane |
| SMILES | CCC(CC1CC2CC3C(CC)C(C)C3C3C1C23)C(C)C |
| InChI | InChI=1S/C21H36/c1-6-13(11(3)4)8-14-9-15-10-17-16(7-2)12(5)18(17)21-19(14)20(15)21/h11-21H,6-10H2,1-5H3 |
| InChIKey | DHARVBILUHXDAQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane?
The IUPAC name of 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane (CID 123187249) is 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane.
What is the SMILES notation for 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane?
The canonical SMILES for 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane is CCC(CC1CC2CC3C(CC)C(C)C3C3C1C23)C(C)C.
What is the InChIKey of 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane?
The InChIKey is DHARVBILUHXDAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36/c1-6-13(11(3)4)8-14-9-15-10-17-16(7-2)12(5)18(17)21-19(14)20(15)21/h11-21H,6-10H2,1-5H3.
What are the key properties of 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane?
5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane has a molecular weight of 288.52 g/mol, XLogP of 5.87, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-10-(2-ethyl-3-methylbutyl)-4-methyltetracyclo[6.3.0.02,11.03,6]undecane is sourced from PubChem (CID 123187249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).