C31H48O4 — CID 123187629
(3E)-4-[(2E)-8-ethenyl-3,5,5,10,10,13-hexamethyltetradeca-2,7,12-trienyl]-3-ethylidene-5-hydroxy-6-methoxycyclohexane-1,2-dione (PubChem CID 123187629) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is (3E)-4-[(2E)-8-ethenyl-3,5,5,10,10,13-hexamethyltetradeca-2,7,12-trienyl]-3-ethylidene-5-hydroxy-6-methoxycyclohexane-1,2-dione.
| Compound Name | (3E)-4-[(2E)-8-ethenyl-3,5,5,10,10,13-hexamethyltetradeca-2,7,12-trienyl]-3-ethylidene-5-hydroxy-6-methoxycyclohexane-1,2-dione |
|---|---|
| PubChem CID | 123187629 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | (3E)-4-[(2E)-8-ethenyl-3,5,5,10,10,13-hexamethyltetradeca-2,7,12-trienyl]-3-ethylidene-5-hydroxy-6-methoxycyclohexane-1,2-dione |
| SMILES | C=CC(=CCC(C)(C)C/C(C)=C/CC1/C(=C\C)C(=O)C(=O)C(OC)C1O)CC(C)(C)CC=C(C)C |
| InChI | InChI=1S/C31H48O4/c1-11-23(20-31(8,9)17-15-21(3)4)16-18-30(6,7)19-22(5)13-14-25-24(12-2)26(32)28(34)29(35-10)27(25)33/h11-13,15-16,25,27,29,33H,1,14,17-20H2,2-10H3/b22-13+,23-16?,24-12+ |
| InChIKey | WUXZEDZUYDAVPA-ISPZNTATSA-N |
| XLogP | 7.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|