About ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate
ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate (PubChem CID 123188261) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate |
| PubChem CID | 123188261 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate |
| SMILES | CCOC(=O)CC(C)c1nnc(C)o1 |
| InChI | InChI=1S/C9H14N2O3/c1-4-13-8(12)5-6(2)9-11-10-7(3)14-9/h6H,4-5H2,1-3H3 |
| InChIKey | VWTBUOODTMZWTF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate?
The IUPAC name of ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate (CID 123188261) is ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate.
What is the SMILES notation for ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate?
The canonical SMILES for ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate is CCOC(=O)CC(C)c1nnc(C)o1.
What is the InChIKey of ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate?
The InChIKey is VWTBUOODTMZWTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-4-13-8(12)5-6(2)9-11-10-7(3)14-9/h6H,4-5H2,1-3H3.
What are the key properties of ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate?
ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate has a molecular weight of 198.22 g/mol, XLogP of 1.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)butanoate is sourced from PubChem (CID 123188261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).