C15H19ClN2O3 — CID 123188323
6-chloro-3-(3,3-dimethyl-5-nitropentyl)-1,3-dihydroindol-2-one (PubChem CID 123188323) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 6-chloro-3-(3,3-dimethyl-5-nitropentyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-3-(3,3-dimethyl-5-nitropentyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 123188323 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 6-chloro-3-(3,3-dimethyl-5-nitropentyl)-1,3-dihydroindol-2-one |
| SMILES | CC(C)(CCC1C(=O)Nc2cc(Cl)ccc21)CC[N+](=O)[O-] |
| InChI | InChI=1S/C15H19ClN2O3/c1-15(2,7-8-18(20)21)6-5-12-11-4-3-10(16)9-13(11)17-14(12)19/h3-4,9,12H,5-8H2,1-2H3,(H,17,19) |
| InChIKey | OJNKUKKODCZKJT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|