About 3-fluoropyrrol-1-amine
3-fluoropyrrol-1-amine (PubChem CID 123188332) has the molecular formula C4H5FN2
and a molecular weight of 100.10 g/mol. Its IUPAC name is 3-fluoropyrrol-1-amine.
Molecular Properties
| Compound Name | 3-fluoropyrrol-1-amine |
| PubChem CID | 123188332 |
| Molecular Formula | C4H5FN2 |
| Molecular Weight | 100.10 g/mol |
| Exact Mass | 100.04 |
| IUPAC Name | 3-fluoropyrrol-1-amine |
| SMILES | Nn1ccc(F)c1 |
| InChI | InChI=1S/C4H5FN2/c5-4-1-2-7(6)3-4/h1-3H,6H2 |
| InChIKey | BSAVGNQPKNLXJN-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.10 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoropyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropyrrol-1-amine?
The IUPAC name of 3-fluoropyrrol-1-amine (CID 123188332) is 3-fluoropyrrol-1-amine.
What is the SMILES notation for 3-fluoropyrrol-1-amine?
The canonical SMILES for 3-fluoropyrrol-1-amine is Nn1ccc(F)c1.
What is the InChIKey of 3-fluoropyrrol-1-amine?
The InChIKey is BSAVGNQPKNLXJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FN2/c5-4-1-2-7(6)3-4/h1-3H,6H2.
What are the key properties of 3-fluoropyrrol-1-amine?
3-fluoropyrrol-1-amine has a molecular weight of 100.10 g/mol, XLogP of 0.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropyrrol-1-amine is sourced from PubChem (CID 123188332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).