About (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate
(4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate (PubChem CID 123188393) has the molecular formula C16H17ClN2O5S
and a molecular weight of 384.84 g/mol. Its IUPAC name is (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate.
Molecular Properties
| Compound Name | (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate |
| PubChem CID | 123188393 |
| Molecular Formula | C16H17ClN2O5S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate |
| SMILES | O=C(NCCCl)NCc1ccc(S(=O)(=O)Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C16H17ClN2O5S/c17-9-10-18-16(21)19-11-12-1-7-15(8-2-12)25(22,23)24-14-5-3-13(20)4-6-14/h1-8,20H,9-11H2,(H2,18,19,21) |
| InChIKey | RRNMNVVZHMMFJZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate?
The IUPAC name of (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate (CID 123188393) is (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate.
What is the SMILES notation for (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate?
The canonical SMILES for (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate is O=C(NCCCl)NCc1ccc(S(=O)(=O)Oc2ccc(O)cc2)cc1.
What is the InChIKey of (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate?
The InChIKey is RRNMNVVZHMMFJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2O5S/c17-9-10-18-16(21)19-11-12-1-7-15(8-2-12)25(22,23)24-14-5-3-13(20)4-6-14/h1-8,20H,9-11H2,(H2,18,19,21).
What are the key properties of (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate?
(4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate has a molecular weight of 384.84 g/mol, XLogP of 2.20, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl) 4-[(2-chloroethylcarbamoylamino)methyl]benzenesulfonate is sourced from PubChem (CID 123188393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).