C37H30BBrN2O2 — CID 123188465
3-bromo-15-(4,6-diphenyl-2-pyridinyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaene (PubChem CID 123188465) has the molecular formula C37H30BBrN2O2 and a molecular weight of 625.38 g/mol. Its IUPAC name is 3-bromo-15-(4,6-diphenyl-2-pyridinyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaene.
| Compound Name | 3-bromo-15-(4,6-diphenyl-2-pyridinyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaene |
|---|---|
| PubChem CID | 123188465 |
| Molecular Formula | C37H30BBrN2O2 |
| Molecular Weight | 625.38 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | 3-bromo-15-(4,6-diphenyl-2-pyridinyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaene |
| SMILES | CC1(C)OB(c2cc3ccc4cc(Br)cc5c4c3c(c2)n5-c2cc(-c3ccccc3)cc(-c3ccccc3)n2)OC1(C)C |
| InChI | InChI=1S/C37H30BBrN2O2/c1-36(2)37(3,4)43-38(42-36)28-17-25-15-16-26-18-29(39)22-32-35(26)34(25)31(21-28)41(32)33-20-27(23-11-7-5-8-12-23)19-30(40-33)24-13-9-6-10-14-24/h5-22H,1-4H3 |
| InChIKey | KIVZEUVMTFAQCH-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.38 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|