C20H27F6NO7S2 — CID 123188665
2-(2-phenyl-1,3-dioxolan-2-yl)ethyl 1,1,2,2,3,3-hexafluoro-3-(hydroxy-methyl-oxo-piperidin-1-yl-λ6-sulfanyl)propane-1-sulfonate (PubChem CID 123188665) has the molecular formula C20H27F6NO7S2 and a molecular weight of 571.56 g/mol. Its IUPAC name is 2-(2-phenyl-1,3-dioxolan-2-yl)ethyl 1,1,2,2,3,3-hexafluoro-3-(hydroxy-methyl-oxo-piperidin-1-yl-λ6-sulfanyl)propane-1-sulfonate.
| Compound Name | 2-(2-phenyl-1,3-dioxolan-2-yl)ethyl 1,1,2,2,3,3-hexafluoro-3-(hydroxy-methyl-oxo-piperidin-1-yl-λ6-sulfanyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 123188665 |
| Molecular Formula | C20H27F6NO7S2 |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | 2-(2-phenyl-1,3-dioxolan-2-yl)ethyl 1,1,2,2,3,3-hexafluoro-3-(hydroxy-methyl-oxo-piperidin-1-yl-λ6-sulfanyl)propane-1-sulfonate |
| SMILES | CS(=O)(O)(N1CCCCC1)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)OCCC1(c2ccccc2)OCCO1 |
| InChI | InChI=1S/C20H27F6NO7S2/c1-36(30,31,27-11-6-3-7-12-27)20(25,26)18(21,22)19(23,24)35(28,29)34-13-10-17(32-14-15-33-17)16-8-4-2-5-9-16/h2,4-5,8-9H,3,6-7,10-15H2,1H3,(H,30,31) |
| InChIKey | WJNPSAJCSLGOIX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|