About 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile
3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile (PubChem CID 123188925) has the molecular formula C5H9N5O
and a molecular weight of 155.16 g/mol. Its IUPAC name is 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile |
| PubChem CID | 123188925 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile |
| SMILES | N#CCC(N)C1NNC(=O)N1 |
| InChI | InChI=1S/C5H9N5O/c6-2-1-3(7)4-8-5(11)10-9-4/h3-4,9H,1,7H2,(H2,8,10,11) |
| InChIKey | NPWNTRIMUXEZHR-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile?
The IUPAC name of 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile (CID 123188925) is 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile.
What is the SMILES notation for 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile?
The canonical SMILES for 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile is N#CCC(N)C1NNC(=O)N1.
What is the InChIKey of 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile?
The InChIKey is NPWNTRIMUXEZHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O/c6-2-1-3(7)4-8-5(11)10-9-4/h3-4,9H,1,7H2,(H2,8,10,11).
What are the key properties of 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile?
3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile has a molecular weight of 155.16 g/mol, XLogP of -1.63, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(5-oxo-1,2,4-triazolidin-3-yl)propanenitrile is sourced from PubChem (CID 123188925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).