About butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium
butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium (PubChem CID 123189357) has the molecular formula C13H26N+
and a molecular weight of 196.36 g/mol. Its IUPAC name is butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium.
Molecular Properties
| Compound Name | butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium |
| PubChem CID | 123189357 |
| Molecular Formula | C13H26N+ |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.21 |
| IUPAC Name | butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium |
| SMILES | C/C=[N+](/C=CC(C)C(C)C)CCCC |
| InChI | InChI=1S/C13H26N/c1-6-8-10-14(7-2)11-9-13(5)12(3)4/h7,9,11-13H,6,8,10H2,1-5H3/q+1/b11-9?,14-7+ |
| InChIKey | DFXGTRIVPGTNHD-JTOAWNLBSA-N |
| XLogP | 3.70 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium?
The IUPAC name of butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium (CID 123189357) is butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium.
What is the SMILES notation for butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium?
The canonical SMILES for butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium is C/C=[N+](/C=CC(C)C(C)C)CCCC.
What is the InChIKey of butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium?
The InChIKey is DFXGTRIVPGTNHD-JTOAWNLBSA-N. The full InChI is InChI=1S/C13H26N/c1-6-8-10-14(7-2)11-9-13(5)12(3)4/h7,9,11-13H,6,8,10H2,1-5H3/q+1/b11-9?,14-7+.
What are the key properties of butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium?
butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium has a molecular weight of 196.36 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-(3,4-dimethylpent-1-enyl)-ethylideneazanium is sourced from PubChem (CID 123189357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).