C16H18N6OS2 — CID 123189450
1-pentyl-1-sulfanyl-3-[3-(1,3-thiazol-5-yl)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 123189450) has the molecular formula C16H18N6OS2 and a molecular weight of 374.50 g/mol. Its IUPAC name is 1-pentyl-1-sulfanyl-3-[3-(1,3-thiazol-5-yl)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-pentyl-1-sulfanyl-3-[3-(1,3-thiazol-5-yl)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 123189450 |
| Molecular Formula | C16H18N6OS2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-pentyl-1-sulfanyl-3-[3-(1,3-thiazol-5-yl)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | CCCCCN(S)C(=O)Nc1ccc2ncc(-c3cncs3)nc2n1 |
| InChI | InChI=1S/C16H18N6OS2/c1-2-3-4-7-22(24)16(23)21-14-6-5-11-15(20-14)19-12(8-18-11)13-9-17-10-25-13/h5-6,8-10,24H,2-4,7H2,1H3,(H,19,20,21,23) |
| InChIKey | BMEBXTRSTZMGJH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|