C15H12F5N3O — CID 123189877
2-[5-(4,5-difluoro-2-methanimidoylanilino)-3-pyridinyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 123189877) has the molecular formula C15H12F5N3O and a molecular weight of 345.27 g/mol. Its IUPAC name is 2-[5-(4,5-difluoro-2-methanimidoylanilino)-3-pyridinyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[5-(4,5-difluoro-2-methanimidoylanilino)-3-pyridinyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 123189877 |
| Molecular Formula | C15H12F5N3O |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[5-(4,5-difluoro-2-methanimidoylanilino)-3-pyridinyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | [H]/N=C/c1cc(F)c(F)cc1Nc1cncc(C(C)(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F5N3O/c1-14(24,15(18,19)20)9-3-10(7-22-6-9)23-13-4-12(17)11(16)2-8(13)5-21/h2-7,21,23-24H,1H3/b21-5+ |
| InChIKey | LUBGBXJBQJIXRM-IGCPIRJNSA-N |
| XLogP | 3.87 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|