About 6-cyclopropyl-3,4-dihydroazepin-2-imine
6-cyclopropyl-3,4-dihydroazepin-2-imine (PubChem CID 123190073) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 6-cyclopropyl-3,4-dihydroazepin-2-imine.
Molecular Properties
| Compound Name | 6-cyclopropyl-3,4-dihydroazepin-2-imine |
| PubChem CID | 123190073 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 6-cyclopropyl-3,4-dihydroazepin-2-imine |
| SMILES | [H]/N=C1\CCC=C(C2CC2)C=N1 |
| InChI | InChI=1S/C9H12N2/c10-9-3-1-2-8(6-11-9)7-4-5-7/h2,6-7,10H,1,3-5H2/b10-9+ |
| InChIKey | BMMNIASXDPSZCH-MDZDMXLPSA-N |
| XLogP | 2.16 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclopropyl-3,4-dihydroazepin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-3,4-dihydroazepin-2-imine?
The IUPAC name of 6-cyclopropyl-3,4-dihydroazepin-2-imine (CID 123190073) is 6-cyclopropyl-3,4-dihydroazepin-2-imine.
What is the SMILES notation for 6-cyclopropyl-3,4-dihydroazepin-2-imine?
The canonical SMILES for 6-cyclopropyl-3,4-dihydroazepin-2-imine is [H]/N=C1\CCC=C(C2CC2)C=N1.
What is the InChIKey of 6-cyclopropyl-3,4-dihydroazepin-2-imine?
The InChIKey is BMMNIASXDPSZCH-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H12N2/c10-9-3-1-2-8(6-11-9)7-4-5-7/h2,6-7,10H,1,3-5H2/b10-9+.
What are the key properties of 6-cyclopropyl-3,4-dihydroazepin-2-imine?
6-cyclopropyl-3,4-dihydroazepin-2-imine has a molecular weight of 148.21 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-3,4-dihydroazepin-2-imine is sourced from PubChem (CID 123190073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).