About 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene
1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene (PubChem CID 123190336) has the molecular formula C11H14F2O
and a molecular weight of 200.23 g/mol. Its IUPAC name is 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene.
Molecular Properties
| Compound Name | 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene |
| PubChem CID | 123190336 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene |
| SMILES | C#CCOC(C=CCF)=C(F)C(C)C |
| InChI | InChI=1S/C11H14F2O/c1-4-8-14-10(6-5-7-12)11(13)9(2)3/h1,5-6,9H,7-8H2,2-3H3 |
| InChIKey | PGFDYHAZAGWBBV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene?
The IUPAC name of 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene (CID 123190336) is 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene.
What is the SMILES notation for 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene?
The canonical SMILES for 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene is C#CCOC(C=CCF)=C(F)C(C)C.
What is the InChIKey of 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene?
The InChIKey is PGFDYHAZAGWBBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O/c1-4-8-14-10(6-5-7-12)11(13)9(2)3/h1,5-6,9H,7-8H2,2-3H3.
What are the key properties of 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene?
1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene has a molecular weight of 200.23 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-difluoro-6-methyl-4-prop-2-ynoxyhepta-2,4-diene is sourced from PubChem (CID 123190336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).