About 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane
4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane (PubChem CID 123190341) has the molecular formula C13H22N2O3S
and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane |
| PubChem CID | 123190341 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane |
| SMILES | C=CC=C(C)S(=O)(=O)N1CCC2(CC1)OCCN2C |
| InChI | InChI=1S/C13H22N2O3S/c1-4-5-12(2)19(16,17)15-8-6-13(7-9-15)14(3)10-11-18-13/h4-5H,1,6-11H2,2-3H3 |
| InChIKey | WVADYEAIOMUTML-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane?
The IUPAC name of 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane (CID 123190341) is 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane.
What is the SMILES notation for 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane?
The canonical SMILES for 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane is C=CC=C(C)S(=O)(=O)N1CCC2(CC1)OCCN2C.
What is the InChIKey of 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane?
The InChIKey is WVADYEAIOMUTML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3S/c1-4-5-12(2)19(16,17)15-8-6-13(7-9-15)14(3)10-11-18-13/h4-5H,1,6-11H2,2-3H3.
What are the key properties of 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane?
4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane has a molecular weight of 286.40 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-8-penta-2,4-dien-2-ylsulfonyl-1-oxa-4,8-diazaspiro[4.5]decane is sourced from PubChem (CID 123190341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).