C15H13NO — CID 123190397
N-(2-methylbut-3-yn-2-yl)tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboxamide (PubChem CID 123190397) has the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. Its IUPAC name is N-(2-methylbut-3-yn-2-yl)tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboxamide.
| Compound Name | N-(2-methylbut-3-yn-2-yl)tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 123190397 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-(2-methylbut-3-yn-2-yl)tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboxamide |
| SMILES | C#CC(C)(C)NC(=O)C1=CC=C2C1=CC1=CC12 |
| InChI | InChI=1S/C15H13NO/c1-4-15(2,3)16-14(17)11-6-5-10-12-7-9(12)8-13(10)11/h1,5-8,12H,2-3H3,(H,16,17) |
| InChIKey | OMUGQPBFPOSTTP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|