C31H40O7SSi — CID 123190729
[(5R)-5-[2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 123190729) has the molecular formula C31H40O7SSi and a molecular weight of 584.81 g/mol. Its IUPAC name is [(5R)-5-[2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(5R)-5-[2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 123190729 |
| Molecular Formula | C31H40O7SSi |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | [(5R)-5-[2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2OC(C)(C)O[C@@H]2C(O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H40O7SSi/c1-23-17-19-24(20-18-23)39(33,34)35-22-28-29(38-31(5,6)37-28)27(32)21-36-40(30(2,3)4,25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-20,27-29,32H,21-22H2,1-6H3/t27?,28?,29-/m1/s1 |
| InChIKey | UAMMBSJXOXVHKK-BVDFDZHASA-N |
| XLogP | 4.16 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|