C31H32N4O2S — CID 123190912
benzyl furan-2-carboximidothioate;1-(furan-2-yl)-2-[3-(1-methylpyrrolidin-3-yl)-1H-indol-5-yl]ethanimine (PubChem CID 123190912) has the molecular formula C31H32N4O2S and a molecular weight of 524.69 g/mol. Its IUPAC name is benzyl furan-2-carboximidothioate;1-(furan-2-yl)-2-[3-(1-methylpyrrolidin-3-yl)-1H-indol-5-yl]ethanimine.
| Compound Name | benzyl furan-2-carboximidothioate;1-(furan-2-yl)-2-[3-(1-methylpyrrolidin-3-yl)-1H-indol-5-yl]ethanimine |
|---|---|
| PubChem CID | 123190912 |
| Molecular Formula | C31H32N4O2S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | benzyl furan-2-carboximidothioate;1-(furan-2-yl)-2-[3-(1-methylpyrrolidin-3-yl)-1H-indol-5-yl]ethanimine |
| SMILES | [H]/N=C(/Cc1ccc2[nH]cc(C3CCN(C)C3)c2c1)c1ccco1.[H]/N=C(\SCc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C19H21N3O.C12H11NOS/c1-22-7-6-14(12-22)16-11-21-18-5-4-13(9-15(16)18)10-17(20)19-3-2-8-23-19;13-12(11-7-4-8-14-11)15-9-10-5-2-1-3-6-10/h2-5,8-9,11,14,20-21H,6-7,10,12H2,1H3;1-8,13H,9H2/b20-17-;13-12- |
| InChIKey | YZDDQAOCLZKJBR-FMFHVQRQSA-N |
| XLogP | 7.33 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|