C14H17N — CID 123190936
3,9-dimethyl-3,4,4b,5-tetrahydrocarbazole (PubChem CID 123190936) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 3,9-dimethyl-3,4,4b,5-tetrahydrocarbazole.
| Compound Name | 3,9-dimethyl-3,4,4b,5-tetrahydrocarbazole |
|---|---|
| PubChem CID | 123190936 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3,9-dimethyl-3,4,4b,5-tetrahydrocarbazole |
| SMILES | CC1C=CC2=C(C1)C1CC=CC=C1N2C |
| InChI | InChI=1S/C14H17N/c1-10-7-8-14-12(9-10)11-5-3-4-6-13(11)15(14)2/h3-4,6-8,10-11H,5,9H2,1-2H3 |
| InChIKey | OSHQXZOLOWAMGX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |