C20H26F6N2O — CID 123190965
2-[4-(4-tert-butylpiperazin-1-yl)-3-prop-1-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 123190965) has the molecular formula C20H26F6N2O and a molecular weight of 424.43 g/mol. Its IUPAC name is 2-[4-(4-tert-butylpiperazin-1-yl)-3-prop-1-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-(4-tert-butylpiperazin-1-yl)-3-prop-1-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 123190965 |
| Molecular Formula | C20H26F6N2O |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[4-(4-tert-butylpiperazin-1-yl)-3-prop-1-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC=Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H26F6N2O/c1-5-6-14-13-15(18(29,19(21,22)23)20(24,25)26)7-8-16(14)27-9-11-28(12-10-27)17(2,3)4/h5-8,13,29H,9-12H2,1-4H3 |
| InChIKey | ANMOHSQAXBLEHF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|