C38H50Cl2N6O2 — CID 123190998
3-[1-[[5-[2-(cyclohexylamino)pyrimidin-4-yl]-4-(3,4-dichlorophenyl)-2-piperidin-4-ylimidazol-1-yl]methyl]cyclohexyl]propyl but-2-enoate (PubChem CID 123190998) has the molecular formula C38H50Cl2N6O2 and a molecular weight of 693.76 g/mol. Its IUPAC name is 3-[1-[[5-[2-(cyclohexylamino)pyrimidin-4-yl]-4-(3,4-dichlorophenyl)-2-piperidin-4-ylimidazol-1-yl]methyl]cyclohexyl]propyl but-2-enoate.
| Compound Name | 3-[1-[[5-[2-(cyclohexylamino)pyrimidin-4-yl]-4-(3,4-dichlorophenyl)-2-piperidin-4-ylimidazol-1-yl]methyl]cyclohexyl]propyl but-2-enoate |
|---|---|
| PubChem CID | 123190998 |
| Molecular Formula | C38H50Cl2N6O2 |
| Molecular Weight | 693.76 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | 3-[1-[[5-[2-(cyclohexylamino)pyrimidin-4-yl]-4-(3,4-dichlorophenyl)-2-piperidin-4-ylimidazol-1-yl]methyl]cyclohexyl]propyl but-2-enoate |
| SMILES | CC=CC(=O)OCCCC1(Cn2c(C3CCNCC3)nc(-c3ccc(Cl)c(Cl)c3)c2-c2ccnc(NC3CCCCC3)n2)CCCCC1 |
| InChI | InChI=1S/C38H50Cl2N6O2/c1-2-10-33(47)48-24-9-20-38(18-7-4-8-19-38)26-46-35(32-17-23-42-37(44-32)43-29-11-5-3-6-12-29)34(28-13-14-30(39)31(40)25-28)45-36(46)27-15-21-41-22-16-27/h2,10,13-14,17,23,25,27,29,41H,3-9,11-12,15-16,18-22,24,26H2,1H3,(H,42,43,44) |
| InChIKey | DFXUODRHFYDXPM-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.76 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|