C23H17ClF3N5O — CID 123191112
2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-4,5,5-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 123191112) has the molecular formula C23H17ClF3N5O and a molecular weight of 471.87 g/mol. Its IUPAC name is 2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-4,5,5-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-4,5,5-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 123191112 |
| Molecular Formula | C23H17ClF3N5O |
| Molecular Weight | 471.87 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-4,5,5-trimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1nc(-n2nc(Cc3c(F)ccc(F)c3F)c3cc(Cl)ccc32)nc2c1C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C23H17ClF3N5O/c1-10-18-20(29-21(33)23(18,2)3)30-22(28-10)32-17-7-4-11(24)8-13(17)16(31-32)9-12-14(25)5-6-15(26)19(12)27/h4-8H,9H2,1-3H3,(H,28,29,30,33) |
| InChIKey | MMJFFVVHDNMOLK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|