C20H42B2O4Si2 — CID 123191710
[1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-trimethylsilylethenyl]-trimethylsilane (PubChem CID 123191710) has the molecular formula C20H42B2O4Si2 and a molecular weight of 424.35 g/mol. Its IUPAC name is [1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-trimethylsilylethenyl]-trimethylsilane.
| Compound Name | [1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-trimethylsilylethenyl]-trimethylsilane |
|---|---|
| PubChem CID | 123191710 |
| Molecular Formula | C20H42B2O4Si2 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | [1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-trimethylsilylethenyl]-trimethylsilane |
| SMILES | CC1(C)OB(C(=C(B2OC(C)(C)C(C)(C)O2)[Si](C)(C)C)[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C20H42B2O4Si2/c1-17(2)18(3,4)24-21(23-17)15(27(9,10)11)16(28(12,13)14)22-25-19(5,6)20(7,8)26-22/h1-14H3 |
| InChIKey | NDWBKXUWXCGNFZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|