C21H24ClN5OS — CID 123191728
3-[4-[5-chloro-4-(1-methylbenzimidazol-2-yl)-2-pyridinyl]piperazin-1-yl]thiolane 1-oxide (PubChem CID 123191728) has the molecular formula C21H24ClN5OS and a molecular weight of 429.98 g/mol. Its IUPAC name is 3-[4-[5-chloro-4-(1-methylbenzimidazol-2-yl)-2-pyridinyl]piperazin-1-yl]thiolane 1-oxide.
| Compound Name | 3-[4-[5-chloro-4-(1-methylbenzimidazol-2-yl)-2-pyridinyl]piperazin-1-yl]thiolane 1-oxide |
|---|---|
| PubChem CID | 123191728 |
| Molecular Formula | C21H24ClN5OS |
| Molecular Weight | 429.98 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 3-[4-[5-chloro-4-(1-methylbenzimidazol-2-yl)-2-pyridinyl]piperazin-1-yl]thiolane 1-oxide |
| SMILES | Cn1c(-c2cc(N3CCN(C4CCS(=O)C4)CC3)ncc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C21H24ClN5OS/c1-25-19-5-3-2-4-18(19)24-21(25)16-12-20(23-13-17(16)22)27-9-7-26(8-10-27)15-6-11-29(28)14-15/h2-5,12-13,15H,6-11,14H2,1H3 |
| InChIKey | KLZDCPLWSDQZRR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.98 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |