C50H52O5 — CID 123191732
2,8-bis(4-butylphenoxy)-3,7-dimethyldibenzofuran;2-methoxy-3,7,8-trimethyldibenzofuran (PubChem CID 123191732) has the molecular formula C50H52O5 and a molecular weight of 732.96 g/mol. Its IUPAC name is 2,8-bis(4-butylphenoxy)-3,7-dimethyldibenzofuran;2-methoxy-3,7,8-trimethyldibenzofuran.
| Compound Name | 2,8-bis(4-butylphenoxy)-3,7-dimethyldibenzofuran;2-methoxy-3,7,8-trimethyldibenzofuran |
|---|---|
| PubChem CID | 123191732 |
| Molecular Formula | C50H52O5 |
| Molecular Weight | 732.96 g/mol |
| Exact Mass | 732.38 |
| IUPAC Name | 2,8-bis(4-butylphenoxy)-3,7-dimethyldibenzofuran;2-methoxy-3,7,8-trimethyldibenzofuran |
| SMILES | CCCCc1ccc(Oc2cc3c(cc2C)oc2cc(C)c(Oc4ccc(CCCC)cc4)cc23)cc1.COc1cc2c(cc1C)oc1cc(C)c(C)cc12 |
| InChI | InChI=1S/C34H36O3.C16H16O2/c1-5-7-9-25-11-15-27(16-12-25)35-31-21-29-30-22-32(24(4)20-34(30)37-33(29)19-23(31)3)36-28-17-13-26(14-18-28)10-8-6-2;1-9-5-12-13-8-14(17-4)11(3)7-16(13)18-15(12)6-10(9)2/h11-22H,5-10H2,1-4H3;5-8H,1-4H3 |
| InChIKey | ZHJULRUMKRPHMZ-UHFFFAOYSA-N |
| XLogP | 14.99 |
| TPSA | 53.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.96 |
| LogP ≤ 5 | 14.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |