C32H38N3O4S+ — CID 123191930
[2-carboxy-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-[[4-[(5-cyano-2-pyridinyl)oxy]cyclohexyl]methylidene]-(4-methylcyclohexanecarbonyl)azanium (PubChem CID 123191930) has the molecular formula C32H38N3O4S+ and a molecular weight of 560.74 g/mol. Its IUPAC name is [2-carboxy-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-[[4-[(5-cyano-2-pyridinyl)oxy]cyclohexyl]methylidene]-(4-methylcyclohexanecarbonyl)azanium.
| Compound Name | [2-carboxy-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-[[4-[(5-cyano-2-pyridinyl)oxy]cyclohexyl]methylidene]-(4-methylcyclohexanecarbonyl)azanium |
|---|---|
| PubChem CID | 123191930 |
| Molecular Formula | C32H38N3O4S+ |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | [2-carboxy-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-[[4-[(5-cyano-2-pyridinyl)oxy]cyclohexyl]methylidene]-(4-methylcyclohexanecarbonyl)azanium |
| SMILES | CC1CCC(C(=O)/[N+](=C\C2CCC(Oc3ccc(C#N)cn3)CC2)c2cc(C#CC(C)(C)C)sc2C(=O)O)CC1 |
| InChI | InChI=1S/C32H37N3O4S/c1-21-5-10-24(11-6-21)30(36)35(27-17-26(15-16-32(2,3)4)40-29(27)31(37)38)20-22-7-12-25(13-8-22)39-28-14-9-23(18-33)19-34-28/h9,14,17,19-22,24-25H,5-8,10-13H2,1-4H3/p+1/b35-20- |
| InChIKey | KBYVOVHVVZPDGU-OJYCWLPVSA-O |
| XLogP | 6.82 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|