C34H46ClFN3O+ — CID 123192190
[7-[4-[N-(2-chlorobuta-1,3-dienyl)-C-ethylcarbonimidoyl]piperidin-1-yl]-2-cyclohexyl-7-oxohept-1-en-3-ylidene]-[1-(4-fluoro-3-methylphenyl)ethylidene]azanium (PubChem CID 123192190) has the molecular formula C34H46ClFN3O+ and a molecular weight of 567.21 g/mol. Its IUPAC name is [7-[4-[N-(2-chlorobuta-1,3-dienyl)-C-ethylcarbonimidoyl]piperidin-1-yl]-2-cyclohexyl-7-oxohept-1-en-3-ylidene]-[1-(4-fluoro-3-methylphenyl)ethylidene]azanium.
| Compound Name | [7-[4-[N-(2-chlorobuta-1,3-dienyl)-C-ethylcarbonimidoyl]piperidin-1-yl]-2-cyclohexyl-7-oxohept-1-en-3-ylidene]-[1-(4-fluoro-3-methylphenyl)ethylidene]azanium |
|---|---|
| PubChem CID | 123192190 |
| Molecular Formula | C34H46ClFN3O+ |
| Molecular Weight | 567.21 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | [7-[4-[N-(2-chlorobuta-1,3-dienyl)-C-ethylcarbonimidoyl]piperidin-1-yl]-2-cyclohexyl-7-oxohept-1-en-3-ylidene]-[1-(4-fluoro-3-methylphenyl)ethylidene]azanium |
| SMILES | C=CC(Cl)=C/N=C(\CC)C1CCN(C(=O)CCCC(=[N+]=C(C)c2ccc(F)c(C)c2)C(=C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C34H46ClFN3O/c1-6-30(35)23-37-32(7-2)28-18-20-39(21-19-28)34(40)15-11-14-33(25(4)27-12-9-8-10-13-27)38-26(5)29-16-17-31(36)24(3)22-29/h6,16-17,22-23,27-28H,1,4,7-15,18-21H2,2-3,5H3/q+1/b30-23?,37-32+ |
| InChIKey | VYHLRMPZNOOOAK-NEKRLKECSA-N |
| XLogP | 8.11 |
| TPSA | 46.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.21 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|