C11H25NO — CID 123192207
3-(2-aminoethyl)-2,2,4,4-tetramethylpentan-3-ol (PubChem CID 123192207) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is 3-(2-aminoethyl)-2,2,4,4-tetramethylpentan-3-ol.
| Compound Name | 3-(2-aminoethyl)-2,2,4,4-tetramethylpentan-3-ol |
|---|---|
| PubChem CID | 123192207 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 3-(2-aminoethyl)-2,2,4,4-tetramethylpentan-3-ol |
| SMILES | CC(C)(C)C(O)(CCN)C(C)(C)C |
| InChI | InChI=1S/C11H25NO/c1-9(2,3)11(13,7-8-12)10(4,5)6/h13H,7-8,12H2,1-6H3 |
| InChIKey | GGSHZYDHBWUBGM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |