C50H70Si — CID 123192416
[2-cyclopropyl-4-(2-phenylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-[4-(3,5-ditert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 123192416) has the molecular formula C50H70Si and a molecular weight of 699.20 g/mol. Its IUPAC name is [2-cyclopropyl-4-(2-phenylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-[4-(3,5-ditert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | [2-cyclopropyl-4-(2-phenylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-[4-(3,5-ditert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 123192416 |
| Molecular Formula | C50H70Si |
| Molecular Weight | 699.20 g/mol |
| Exact Mass | 698.52 |
| IUPAC Name | [2-cyclopropyl-4-(2-phenylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-[4-(3,5-ditert-butylphenyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | CC1CC2C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)CCCC2C1[Si](C)(C)C1C(C2CC2)CC2C(c3ccccc3-c3ccccc3)CCCC21 |
| InChI | InChI=1S/C50H70Si/c1-32-27-45-39(35-28-36(49(2,3)4)30-37(29-35)50(5,6)7)21-15-23-42(45)47(32)51(8,9)48-43-24-16-22-41(46(43)31-44(48)34-25-26-34)40-20-14-13-19-38(40)33-17-11-10-12-18-33/h10-14,17-20,28-30,32,34,39,41-48H,15-16,21-27,31H2,1-9H3 |
| InChIKey | QLRXWDBLWRKBSN-UHFFFAOYSA-N |
| XLogP | 14.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.20 |
| LogP ≤ 5 | 14.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|