C11H15Br — CID 123192453
7-bromo-5-methyl-6-methylidenenona-2,4,7-triene (PubChem CID 123192453) has the molecular formula C11H15Br and a molecular weight of 227.14 g/mol. Its IUPAC name is 7-bromo-5-methyl-6-methylidenenona-2,4,7-triene.
| Compound Name | 7-bromo-5-methyl-6-methylidenenona-2,4,7-triene |
|---|---|
| PubChem CID | 123192453 |
| Molecular Formula | C11H15Br |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 7-bromo-5-methyl-6-methylidenenona-2,4,7-triene |
| SMILES | C=C(C(C)=CC=CC)C(Br)=CC |
| InChI | InChI=1S/C11H15Br/c1-5-7-8-9(3)10(4)11(12)6-2/h5-8H,4H2,1-3H3 |
| InChIKey | BFVHJNQCFUFNPO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|